C8H14N4O — CID 60981848
N-(1H-1,2,4-triazol-5-ylmethyl)pentanamide (PubChem CID 60981848) has the molecular formula C8H14N4O and a molecular weight of 182.23 g/mol. Its IUPAC name is N-(1H-1,2,4-triazol-5-ylmethyl)pentanamide.
| Compound Name | N-(1H-1,2,4-triazol-5-ylmethyl)pentanamide |
|---|---|
| PubChem CID | 60981848 |
| Molecular Formula | C8H14N4O |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | N-(1H-1,2,4-triazol-5-ylmethyl)pentanamide |
| SMILES | CCCCC(=O)NCc1ncn[nH]1 |
| InChI | InChI=1S/C8H14N4O/c1-2-3-4-8(13)9-5-7-10-6-11-12-7/h6H,2-5H2,1H3,(H,9,13)(H,10,11,12) |
| InChIKey | VARAFSFVUBORTG-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |