C9H12N4O — CID 60981851
(2E,4E)-N-(1H-1,2,4-triazol-5-ylmethyl)hexa-2,4-dienamide (PubChem CID 60981851) has the molecular formula C9H12N4O and a molecular weight of 192.22 g/mol. Its IUPAC name is (2E,4E)-N-(1H-1,2,4-triazol-5-ylmethyl)hexa-2,4-dienamide.
| Compound Name | (2E,4E)-N-(1H-1,2,4-triazol-5-ylmethyl)hexa-2,4-dienamide |
|---|---|
| PubChem CID | 60981851 |
| Molecular Formula | C9H12N4O |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | (2E,4E)-N-(1H-1,2,4-triazol-5-ylmethyl)hexa-2,4-dienamide |
| SMILES | C/C=C/C=C/C(=O)NCc1ncn[nH]1 |
| InChI | InChI=1S/C9H12N4O/c1-2-3-4-5-9(14)10-6-8-11-7-12-13-8/h2-5,7H,6H2,1H3,(H,10,14)(H,11,12,13)/b3-2+,5-4+ |
| InChIKey | GWRFQMOYYCNJJJ-MQQKCMAXSA-N |
| XLogP | 0.55 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|