C9H14N4O — CID 60981983
N-(1H-1,2,4-triazol-5-ylmethyl)cyclopentanecarboxamide (PubChem CID 60981983) has the molecular formula C9H14N4O and a molecular weight of 194.24 g/mol. Its IUPAC name is N-(1H-1,2,4-triazol-5-ylmethyl)cyclopentanecarboxamide.
| Compound Name | N-(1H-1,2,4-triazol-5-ylmethyl)cyclopentanecarboxamide |
|---|---|
| PubChem CID | 60981983 |
| Molecular Formula | C9H14N4O |
| Molecular Weight | 194.24 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | N-(1H-1,2,4-triazol-5-ylmethyl)cyclopentanecarboxamide |
| SMILES | O=C(NCc1ncn[nH]1)C1CCCC1 |
| InChI | InChI=1S/C9H14N4O/c14-9(7-3-1-2-4-7)10-5-8-11-6-12-13-8/h6-7H,1-5H2,(H,10,14)(H,11,12,13) |
| InChIKey | ZZBRMXYBZGGFNG-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.24 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |