C7H12N4O3S — CID 60982084
3-methylsulfonyl-N-(1H-1,2,4-triazol-5-ylmethyl)propanamide (PubChem CID 60982084) has the molecular formula C7H12N4O3S and a molecular weight of 232.26 g/mol. Its IUPAC name is 3-methylsulfonyl-N-(1H-1,2,4-triazol-5-ylmethyl)propanamide.
| Compound Name | 3-methylsulfonyl-N-(1H-1,2,4-triazol-5-ylmethyl)propanamide |
|---|---|
| PubChem CID | 60982084 |
| Molecular Formula | C7H12N4O3S |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.06 |
| IUPAC Name | 3-methylsulfonyl-N-(1H-1,2,4-triazol-5-ylmethyl)propanamide |
| SMILES | CS(=O)(=O)CCC(=O)NCc1ncn[nH]1 |
| InChI | InChI=1S/C7H12N4O3S/c1-15(13,14)3-2-7(12)8-4-6-9-5-10-11-6/h5H,2-4H2,1H3,(H,8,12)(H,9,10,11) |
| InChIKey | WRMHPAAVDUEJJL-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |