About 4-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)pentanamide
4-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)pentanamide (PubChem CID 60982423) has the molecular formula C9H16N4O
and a molecular weight of 196.25 g/mol. Its IUPAC name is 4-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)pentanamide.
Molecular Properties
| Compound Name | 4-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)pentanamide |
| PubChem CID | 60982423 |
| Molecular Formula | C9H16N4O |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | 4-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)pentanamide |
| SMILES | CC(C)CCC(=O)NCc1ncn[nH]1 |
| InChI | InChI=1S/C9H16N4O/c1-7(2)3-4-9(14)10-5-8-11-6-12-13-8/h6-7H,3-5H2,1-2H3,(H,10,14)(H,11,12,13) |
| InChIKey | NNKAOPHAZOPUJM-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)pentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)pentanamide?
The IUPAC name of 4-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)pentanamide (CID 60982423) is 4-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)pentanamide.
What is the SMILES notation for 4-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)pentanamide?
The canonical SMILES for 4-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)pentanamide is CC(C)CCC(=O)NCc1ncn[nH]1.
What is the InChIKey of 4-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)pentanamide?
The InChIKey is NNKAOPHAZOPUJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N4O/c1-7(2)3-4-9(14)10-5-8-11-6-12-13-8/h6-7H,3-5H2,1-2H3,(H,10,14)(H,11,12,13).
What are the key properties of 4-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)pentanamide?
4-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)pentanamide has a molecular weight of 196.25 g/mol, XLogP of 0.86, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)pentanamide is sourced from PubChem (CID 60982423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).