About 2-[(2-ethyl-1,3-thiazol-5-yl)methylamino]acetic acid
2-[(2-ethyl-1,3-thiazol-5-yl)methylamino]acetic acid (PubChem CID 60982758) has the molecular formula C8H12N2O2S
and a molecular weight of 200.26 g/mol. Its IUPAC name is 2-[(2-ethyl-1,3-thiazol-5-yl)methylamino]acetic acid.
Molecular Properties
| Compound Name | 2-[(2-ethyl-1,3-thiazol-5-yl)methylamino]acetic acid |
| PubChem CID | 60982758 |
| Molecular Formula | C8H12N2O2S |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | 2-[(2-ethyl-1,3-thiazol-5-yl)methylamino]acetic acid |
| SMILES | CCc1ncc(CNCC(=O)O)s1 |
| InChI | InChI=1S/C8H12N2O2S/c1-2-7-10-4-6(13-7)3-9-5-8(11)12/h4,9H,2-3,5H2,1H3,(H,11,12) |
| InChIKey | AKXWUHGFIPAMBR-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(2-ethyl-1,3-thiazol-5-yl)methylamino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-ethyl-1,3-thiazol-5-yl)methylamino]acetic acid?
The IUPAC name of 2-[(2-ethyl-1,3-thiazol-5-yl)methylamino]acetic acid (CID 60982758) is 2-[(2-ethyl-1,3-thiazol-5-yl)methylamino]acetic acid.
What is the SMILES notation for 2-[(2-ethyl-1,3-thiazol-5-yl)methylamino]acetic acid?
The canonical SMILES for 2-[(2-ethyl-1,3-thiazol-5-yl)methylamino]acetic acid is CCc1ncc(CNCC(=O)O)s1.
What is the InChIKey of 2-[(2-ethyl-1,3-thiazol-5-yl)methylamino]acetic acid?
The InChIKey is AKXWUHGFIPAMBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2S/c1-2-7-10-4-6(13-7)3-9-5-8(11)12/h4,9H,2-3,5H2,1H3,(H,11,12).
What are the key properties of 2-[(2-ethyl-1,3-thiazol-5-yl)methylamino]acetic acid?
2-[(2-ethyl-1,3-thiazol-5-yl)methylamino]acetic acid has a molecular weight of 200.26 g/mol, XLogP of 0.88, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-ethyl-1,3-thiazol-5-yl)methylamino]acetic acid is sourced from PubChem (CID 60982758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).