C17H23N3S — CID 60982783
1-benzyl-N-[(2-ethyl-1,3-thiazol-5-yl)methyl]pyrrolidin-3-amine (PubChem CID 60982783) has the molecular formula C17H23N3S and a molecular weight of 301.46 g/mol. Its IUPAC name is 1-benzyl-N-[(2-ethyl-1,3-thiazol-5-yl)methyl]pyrrolidin-3-amine.
| Compound Name | 1-benzyl-N-[(2-ethyl-1,3-thiazol-5-yl)methyl]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 60982783 |
| Molecular Formula | C17H23N3S |
| Molecular Weight | 301.46 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | 1-benzyl-N-[(2-ethyl-1,3-thiazol-5-yl)methyl]pyrrolidin-3-amine |
| SMILES | CCc1ncc(CNC2CCN(Cc3ccccc3)C2)s1 |
| InChI | InChI=1S/C17H23N3S/c1-2-17-19-11-16(21-17)10-18-15-8-9-20(13-15)12-14-6-4-3-5-7-14/h3-7,11,15,18H,2,8-10,12-13H2,1H3 |
| InChIKey | YWEHMBCRLBYHTJ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.46 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |