About N-(1H-1,2,4-triazol-5-ylmethyl)propane-2-sulfonamide
N-(1H-1,2,4-triazol-5-ylmethyl)propane-2-sulfonamide (PubChem CID 60982945) has the molecular formula C6H12N4O2S
and a molecular weight of 204.25 g/mol. Its IUPAC name is N-(1H-1,2,4-triazol-5-ylmethyl)propane-2-sulfonamide.
Molecular Properties
| Compound Name | N-(1H-1,2,4-triazol-5-ylmethyl)propane-2-sulfonamide |
| PubChem CID | 60982945 |
| Molecular Formula | C6H12N4O2S |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | N-(1H-1,2,4-triazol-5-ylmethyl)propane-2-sulfonamide |
| SMILES | CC(C)S(=O)(=O)NCc1ncn[nH]1 |
| InChI | InChI=1S/C6H12N4O2S/c1-5(2)13(11,12)9-3-6-7-4-8-10-6/h4-5,9H,3H2,1-2H3,(H,7,8,10) |
| InChIKey | AFVKGQCAQXIEIE-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(1H-1,2,4-triazol-5-ylmethyl)propane-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1H-1,2,4-triazol-5-ylmethyl)propane-2-sulfonamide?
The IUPAC name of N-(1H-1,2,4-triazol-5-ylmethyl)propane-2-sulfonamide (CID 60982945) is N-(1H-1,2,4-triazol-5-ylmethyl)propane-2-sulfonamide.
What is the SMILES notation for N-(1H-1,2,4-triazol-5-ylmethyl)propane-2-sulfonamide?
The canonical SMILES for N-(1H-1,2,4-triazol-5-ylmethyl)propane-2-sulfonamide is CC(C)S(=O)(=O)NCc1ncn[nH]1.
What is the InChIKey of N-(1H-1,2,4-triazol-5-ylmethyl)propane-2-sulfonamide?
The InChIKey is AFVKGQCAQXIEIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N4O2S/c1-5(2)13(11,12)9-3-6-7-4-8-10-6/h4-5,9H,3H2,1-2H3,(H,7,8,10).
What are the key properties of N-(1H-1,2,4-triazol-5-ylmethyl)propane-2-sulfonamide?
N-(1H-1,2,4-triazol-5-ylmethyl)propane-2-sulfonamide has a molecular weight of 204.25 g/mol, XLogP of -0.37, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1H-1,2,4-triazol-5-ylmethyl)propane-2-sulfonamide is sourced from PubChem (CID 60982945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).