C9H14N4O — CID 60983051
(E)-2-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)pent-2-enamide (PubChem CID 60983051) has the molecular formula C9H14N4O and a molecular weight of 194.24 g/mol. Its IUPAC name is (E)-2-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)pent-2-enamide.
| Compound Name | (E)-2-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)pent-2-enamide |
|---|---|
| PubChem CID | 60983051 |
| Molecular Formula | C9H14N4O |
| Molecular Weight | 194.24 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | (E)-2-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)pent-2-enamide |
| SMILES | CC/C=C(\C)C(=O)NCc1ncn[nH]1 |
| InChI | InChI=1S/C9H14N4O/c1-3-4-7(2)9(14)10-5-8-11-6-12-13-8/h4,6H,3,5H2,1-2H3,(H,10,14)(H,11,12,13)/b7-4+ |
| InChIKey | ABLWRKKYAFOUPW-QPJJXVBHSA-N |
| XLogP | 0.78 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.24 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|