C9H7F2N5O4S — CID 60983327
2,4-difluoro-5-nitro-N-(1H-1,2,4-triazol-5-ylmethyl)benzenesulfonamide (PubChem CID 60983327) has the molecular formula C9H7F2N5O4S and a molecular weight of 319.25 g/mol. Its IUPAC name is 2,4-difluoro-5-nitro-N-(1H-1,2,4-triazol-5-ylmethyl)benzenesulfonamide.
| Compound Name | 2,4-difluoro-5-nitro-N-(1H-1,2,4-triazol-5-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 60983327 |
| Molecular Formula | C9H7F2N5O4S |
| Molecular Weight | 319.25 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | 2,4-difluoro-5-nitro-N-(1H-1,2,4-triazol-5-ylmethyl)benzenesulfonamide |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)NCc2ncn[nH]2)c(F)cc1F |
| InChI | InChI=1S/C9H7F2N5O4S/c10-5-1-6(11)8(2-7(5)16(17)18)21(19,20)14-3-9-12-4-13-15-9/h1-2,4,14H,3H2,(H,12,13,15) |
| InChIKey | RSKIMCQPHFQWMP-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.25 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|