About (E)-N-(1H-1,2,4-triazol-5-ylmethyl)but-2-enamide
(E)-N-(1H-1,2,4-triazol-5-ylmethyl)but-2-enamide (PubChem CID 60983564) has the molecular formula C7H10N4O
and a molecular weight of 166.18 g/mol. Its IUPAC name is (E)-N-(1H-1,2,4-triazol-5-ylmethyl)but-2-enamide.
Molecular Properties
| Compound Name | (E)-N-(1H-1,2,4-triazol-5-ylmethyl)but-2-enamide |
| PubChem CID | 60983564 |
| Molecular Formula | C7H10N4O |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.09 |
| IUPAC Name | (E)-N-(1H-1,2,4-triazol-5-ylmethyl)but-2-enamide |
| SMILES | C/C=C/C(=O)NCc1ncn[nH]1 |
| InChI | InChI=1S/C7H10N4O/c1-2-3-7(12)8-4-6-9-5-10-11-6/h2-3,5H,4H2,1H3,(H,8,12)(H,9,10,11)/b3-2+ |
| InChIKey | FHAMVQCVPDJFIF-NSCUHMNNSA-N |
| XLogP | -0.00 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-(1H-1,2,4-triazol-5-ylmethyl)but-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-(1H-1,2,4-triazol-5-ylmethyl)but-2-enamide?
The IUPAC name of (E)-N-(1H-1,2,4-triazol-5-ylmethyl)but-2-enamide (CID 60983564) is (E)-N-(1H-1,2,4-triazol-5-ylmethyl)but-2-enamide.
What is the SMILES notation for (E)-N-(1H-1,2,4-triazol-5-ylmethyl)but-2-enamide?
The canonical SMILES for (E)-N-(1H-1,2,4-triazol-5-ylmethyl)but-2-enamide is C/C=C/C(=O)NCc1ncn[nH]1.
What is the InChIKey of (E)-N-(1H-1,2,4-triazol-5-ylmethyl)but-2-enamide?
The InChIKey is FHAMVQCVPDJFIF-NSCUHMNNSA-N. The full InChI is InChI=1S/C7H10N4O/c1-2-3-7(12)8-4-6-9-5-10-11-6/h2-3,5H,4H2,1H3,(H,8,12)(H,9,10,11)/b3-2+.
What are the key properties of (E)-N-(1H-1,2,4-triazol-5-ylmethyl)but-2-enamide?
(E)-N-(1H-1,2,4-triazol-5-ylmethyl)but-2-enamide has a molecular weight of 166.18 g/mol, XLogP of -0.00, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-(1H-1,2,4-triazol-5-ylmethyl)but-2-enamide is sourced from PubChem (CID 60983564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).