C11H12FN5O3S — CID 60983592
N-[3-fluoro-4-(1H-1,2,4-triazol-5-ylmethylsulfamoyl)phenyl]acetamide (PubChem CID 60983592) has the molecular formula C11H12FN5O3S and a molecular weight of 313.31 g/mol. Its IUPAC name is N-[3-fluoro-4-(1H-1,2,4-triazol-5-ylmethylsulfamoyl)phenyl]acetamide.
| Compound Name | N-[3-fluoro-4-(1H-1,2,4-triazol-5-ylmethylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 60983592 |
| Molecular Formula | C11H12FN5O3S |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | N-[3-fluoro-4-(1H-1,2,4-triazol-5-ylmethylsulfamoyl)phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)NCc2ncn[nH]2)c(F)c1 |
| InChI | InChI=1S/C11H12FN5O3S/c1-7(18)16-8-2-3-10(9(12)4-8)21(19,20)15-5-11-13-6-14-17-11/h2-4,6,15H,5H2,1H3,(H,16,18)(H,13,14,17) |
| InChIKey | FZBHPZNCWPWCEH-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |