C6H2Cl2N2OS — CID 60984120
5-chloro-3-(5-chlorothiophen-2-yl)-1,2,4-oxadiazole (PubChem CID 60984120) has the molecular formula C6H2Cl2N2OS and a molecular weight of 221.07 g/mol. Its IUPAC name is 5-chloro-3-(5-chlorothiophen-2-yl)-1,2,4-oxadiazole.
| Compound Name | 5-chloro-3-(5-chlorothiophen-2-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 60984120 |
| Molecular Formula | C6H2Cl2N2OS |
| Molecular Weight | 221.07 g/mol |
| Exact Mass | 219.93 |
| IUPAC Name | 5-chloro-3-(5-chlorothiophen-2-yl)-1,2,4-oxadiazole |
| SMILES | Clc1nc(-c2ccc(Cl)s2)no1 |
| InChI | InChI=1S/C6H2Cl2N2OS/c7-4-2-1-3(12-4)5-9-6(8)11-10-5/h1-2H |
| InChIKey | NLHILJFEOFBMEF-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.07 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |