About N-(3-cyano-4,5-dimethylthiophen-2-yl)-4-methyl-2-oxo-3H-1,3-thiazole-5-sulfonamide
N-(3-cyano-4,5-dimethylthiophen-2-yl)-4-methyl-2-oxo-3H-1,3-thiazole-5-sulfonamide (PubChem CID 60984796) has the molecular formula C11H11N3O3S3
and a molecular weight of 329.43 g/mol. Its IUPAC name is N-(3-cyano-4,5-dimethylthiophen-2-yl)-4-methyl-2-oxo-3H-1,3-thiazole-5-sulfonamide.
Molecular Properties
| Compound Name | N-(3-cyano-4,5-dimethylthiophen-2-yl)-4-methyl-2-oxo-3H-1,3-thiazole-5-sulfonamide |
| PubChem CID | 60984796 |
| Molecular Formula | C11H11N3O3S3 |
| Molecular Weight | 329.43 g/mol |
| Exact Mass | 329.00 |
| IUPAC Name | N-(3-cyano-4,5-dimethylthiophen-2-yl)-4-methyl-2-oxo-3H-1,3-thiazole-5-sulfonamide |
| SMILES | Cc1[nH]c(=O)sc1S(=O)(=O)Nc1sc(C)c(C)c1C#N |
| InChI | InChI=1S/C11H11N3O3S3/c1-5-7(3)18-9(8(5)4-12)14-20(16,17)10-6(2)13-11(15)19-10/h14H,1-3H3,(H,13,15) |
| InChIKey | TXNOACWIXILVFU-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 102.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.43 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(3-cyano-4,5-dimethylthiophen-2-yl)-4-methyl-2-oxo-3H-1,3-thiazole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-cyano-4,5-dimethylthiophen-2-yl)-4-methyl-2-oxo-3H-1,3-thiazole-5-sulfonamide?
The IUPAC name of N-(3-cyano-4,5-dimethylthiophen-2-yl)-4-methyl-2-oxo-3H-1,3-thiazole-5-sulfonamide (CID 60984796) is N-(3-cyano-4,5-dimethylthiophen-2-yl)-4-methyl-2-oxo-3H-1,3-thiazole-5-sulfonamide.
What is the SMILES notation for N-(3-cyano-4,5-dimethylthiophen-2-yl)-4-methyl-2-oxo-3H-1,3-thiazole-5-sulfonamide?
The canonical SMILES for N-(3-cyano-4,5-dimethylthiophen-2-yl)-4-methyl-2-oxo-3H-1,3-thiazole-5-sulfonamide is Cc1[nH]c(=O)sc1S(=O)(=O)Nc1sc(C)c(C)c1C#N.
What is the InChIKey of N-(3-cyano-4,5-dimethylthiophen-2-yl)-4-methyl-2-oxo-3H-1,3-thiazole-5-sulfonamide?
The InChIKey is TXNOACWIXILVFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N3O3S3/c1-5-7(3)18-9(8(5)4-12)14-20(16,17)10-6(2)13-11(15)19-10/h14H,1-3H3,(H,13,15).
What are the key properties of N-(3-cyano-4,5-dimethylthiophen-2-yl)-4-methyl-2-oxo-3H-1,3-thiazole-5-sulfonamide?
N-(3-cyano-4,5-dimethylthiophen-2-yl)-4-methyl-2-oxo-3H-1,3-thiazole-5-sulfonamide has a molecular weight of 329.43 g/mol, XLogP of 2.10, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-cyano-4,5-dimethylthiophen-2-yl)-4-methyl-2-oxo-3H-1,3-thiazole-5-sulfonamide is sourced from PubChem (CID 60984796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).