About (2,5-dimethylphenyl) acridine-9-carboxylate
(2,5-dimethylphenyl) acridine-9-carboxylate (PubChem CID 609863) has the molecular formula C22H17NO2
and a molecular weight of 327.38 g/mol. Its IUPAC name is (2,5-dimethylphenyl) acridine-9-carboxylate.
Molecular Properties
| Compound Name | (2,5-dimethylphenyl) acridine-9-carboxylate |
| PubChem CID | 609863 |
| Molecular Formula | C22H17NO2 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | (2,5-dimethylphenyl) acridine-9-carboxylate |
| SMILES | Cc1ccc(C)c(OC(=O)c2c3ccccc3nc3ccccc23)c1 |
| InChI | InChI=1S/C22H17NO2/c1-14-11-12-15(2)20(13-14)25-22(24)21-16-7-3-5-9-18(16)23-19-10-6-4-8-17(19)21/h3-13H,1-2H3 |
| InChIKey | XSOWTYRQEZMPRO-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze (2,5-dimethylphenyl) acridine-9-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dimethylphenyl) acridine-9-carboxylate?
The IUPAC name of (2,5-dimethylphenyl) acridine-9-carboxylate (CID 609863) is (2,5-dimethylphenyl) acridine-9-carboxylate.
What is the SMILES notation for (2,5-dimethylphenyl) acridine-9-carboxylate?
The canonical SMILES for (2,5-dimethylphenyl) acridine-9-carboxylate is Cc1ccc(C)c(OC(=O)c2c3ccccc3nc3ccccc23)c1.
What is the InChIKey of (2,5-dimethylphenyl) acridine-9-carboxylate?
The InChIKey is XSOWTYRQEZMPRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17NO2/c1-14-11-12-15(2)20(13-14)25-22(24)21-16-7-3-5-9-18(16)23-19-10-6-4-8-17(19)21/h3-13H,1-2H3.
What are the key properties of (2,5-dimethylphenyl) acridine-9-carboxylate?
(2,5-dimethylphenyl) acridine-9-carboxylate has a molecular weight of 327.38 g/mol, XLogP of 5.22, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dimethylphenyl) acridine-9-carboxylate is sourced from PubChem (CID 609863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).