3-[methyl(2-morpholin-4-ylethyl)amino]propanoic acid

C10H20N2O3 — CID 60987134

IUPAC3-[methyl(2-morpholin-4-ylethyl)amino]propanoic acid
SMILESCN(CCC(=O)O)CCN1CCOCC1
InChIInChI=1S/C10H20N2O3/c1-11(3-2-10(13)14)4-5-12-6-8-15-9-7-12/h2-9H2,1H3,(H,13,14)
InChIKeyOIBHHYJTJLEYDN-UHFFFAOYSA-N
MW216.28 g/mol
LogP-0.27
Rot. Bonds6

About 3-[methyl(2-morpholin-4-ylethyl)amino]propanoic acid

3-[methyl(2-morpholin-4-ylethyl)amino]propanoic acid (PubChem CID 60987134) has the molecular formula C10H20N2O3 and a molecular weight of 216.28 g/mol. Its IUPAC name is 3-[methyl(2-morpholin-4-ylethyl)amino]propanoic acid.

Molecular Properties

Compound Name3-[methyl(2-morpholin-4-ylethyl)amino]propanoic acid
PubChem CID60987134
Molecular FormulaC10H20N2O3
Molecular Weight216.28 g/mol
Exact Mass216.15
IUPAC Name3-[methyl(2-morpholin-4-ylethyl)amino]propanoic acid
SMILESCN(CCC(=O)O)CCN1CCOCC1
InChIInChI=1S/C10H20N2O3/c1-11(3-2-10(13)14)4-5-12-6-8-15-9-7-12/h2-9H2,1H3,(H,13,14)
InChIKeyOIBHHYJTJLEYDN-UHFFFAOYSA-N
XLogP-0.27
TPSA53.01 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500216.28
LogP ≤ 5-0.27
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 3-[methyl(2-morpholin-4-ylethyl)amino]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

3-[methyl(3-morpholin-4-ylpropyl)amino]propanoic acid
CID 82328722
N,N'-dimethyl-N'-(2-morpholin-4-ylethyl)ethane-1,2-diamine
CID 43374410
N-methyl-N-(2-morpholin-4-ylethyl)-2-nitrosoethanamine
CID 174194198
3-[3-morpholin-4-ylpropyl(propan-2-yl)amino]propanoic acid
CID 82328609
3-[2-morpholin-4-ylethyl-(2,2,2-trifluoroacetyl)amino]propanoic acid
CID 82325840
3-(2-morpholin-4-ylethylamino)propanoic acid
CID 28830354
3-[3-methyl-N-(2-morpholin-4-ylethyl)anilino]propanoic acid
CID 82320048
2-(2-morpholin-4-ylethylamino)acetic acid
CID 28897547
methyl 3-[methyl(2-piperidin-1-ylethyl)amino]propanoate
CID 62010889
N,2-dimethyl-N-(2-morpholin-4-ylethyl)propanamide
CID 22954090
3-[(2-amino-2-oxoethyl)-(3-morpholin-4-ylpropyl)amino]propanoic acid
CID 82326743
2-(dimethylamino)ethyl 3-morpholin-4-ylpropanoate
CID 21449218

Frequently Asked Questions

What is the IUPAC name of 3-[methyl(2-morpholin-4-ylethyl)amino]propanoic acid?
The IUPAC name of 3-[methyl(2-morpholin-4-ylethyl)amino]propanoic acid (CID 60987134) is 3-[methyl(2-morpholin-4-ylethyl)amino]propanoic acid.
What is the SMILES notation for 3-[methyl(2-morpholin-4-ylethyl)amino]propanoic acid?
The canonical SMILES for 3-[methyl(2-morpholin-4-ylethyl)amino]propanoic acid is CN(CCC(=O)O)CCN1CCOCC1.
What is the InChIKey of 3-[methyl(2-morpholin-4-ylethyl)amino]propanoic acid?
The InChIKey is OIBHHYJTJLEYDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O3/c1-11(3-2-10(13)14)4-5-12-6-8-15-9-7-12/h2-9H2,1H3,(H,13,14).
What are the key properties of 3-[methyl(2-morpholin-4-ylethyl)amino]propanoic acid?
3-[methyl(2-morpholin-4-ylethyl)amino]propanoic acid has a molecular weight of 216.28 g/mol, XLogP of -0.27, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[methyl(2-morpholin-4-ylethyl)amino]propanoic acid is sourced from PubChem (CID 60987134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).