About 1-methyl-4-phenyl-1H-2,3-benzodiazepine
1-methyl-4-phenyl-1H-2,3-benzodiazepine (PubChem CID 609887) has the molecular formula C16H14N2
and a molecular weight of 234.30 g/mol. Its IUPAC name is 1-methyl-4-phenyl-1H-2,3-benzodiazepine.
Molecular Properties
| Compound Name | 1-methyl-4-phenyl-1H-2,3-benzodiazepine |
| PubChem CID | 609887 |
| Molecular Formula | C16H14N2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 1-methyl-4-phenyl-1H-2,3-benzodiazepine |
| SMILES | CC1N=NC(c2ccccc2)=Cc2ccccc21 |
| InChI | InChI=1S/C16H14N2/c1-12-15-10-6-5-9-14(15)11-16(18-17-12)13-7-3-2-4-8-13/h2-12H,1H3 |
| InChIKey | WIIDDYTVBKDOKD-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-4-phenyl-1H-2,3-benzodiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4-phenyl-1H-2,3-benzodiazepine?
The IUPAC name of 1-methyl-4-phenyl-1H-2,3-benzodiazepine (CID 609887) is 1-methyl-4-phenyl-1H-2,3-benzodiazepine.
What is the SMILES notation for 1-methyl-4-phenyl-1H-2,3-benzodiazepine?
The canonical SMILES for 1-methyl-4-phenyl-1H-2,3-benzodiazepine is CC1N=NC(c2ccccc2)=Cc2ccccc21.
What is the InChIKey of 1-methyl-4-phenyl-1H-2,3-benzodiazepine?
The InChIKey is WIIDDYTVBKDOKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N2/c1-12-15-10-6-5-9-14(15)11-16(18-17-12)13-7-3-2-4-8-13/h2-12H,1H3.
What are the key properties of 1-methyl-4-phenyl-1H-2,3-benzodiazepine?
1-methyl-4-phenyl-1H-2,3-benzodiazepine has a molecular weight of 234.30 g/mol, XLogP of 4.71, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-phenyl-1H-2,3-benzodiazepine is sourced from PubChem (CID 609887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).