methyl 2-(3-chloroanilino)-2-(2-chloro-6-fluorophenyl)acetate

C15H12Cl2FNO2 — CID 60991814

IUPACmethyl 2-(3-chloroanilino)-2-(2-chloro-6-fluorophenyl)acetate
SMILESCOC(=O)C(Nc1cccc(Cl)c1)c1c(F)cccc1Cl
InChIInChI=1S/C15H12Cl2FNO2/c1-21-15(20)14(13-11(17)6-3-7-12(13)18)19-10-5-2-4-9(16)8-10/h2-8,14,19H,1H3
InChIKeyHHWUITMTOCMYKT-UHFFFAOYSA-N
MW328.17 g/mol
LogP4.46
Rot. Bonds4

About methyl 2-(3-chloroanilino)-2-(2-chloro-6-fluorophenyl)acetate

methyl 2-(3-chloroanilino)-2-(2-chloro-6-fluorophenyl)acetate (PubChem CID 60991814) has the molecular formula C15H12Cl2FNO2 and a molecular weight of 328.17 g/mol. Its IUPAC name is methyl 2-(3-chloroanilino)-2-(2-chloro-6-fluorophenyl)acetate.

Molecular Properties

Compound Namemethyl 2-(3-chloroanilino)-2-(2-chloro-6-fluorophenyl)acetate
PubChem CID60991814
Molecular FormulaC15H12Cl2FNO2
Molecular Weight328.17 g/mol
Exact Mass327.02
IUPAC Namemethyl 2-(3-chloroanilino)-2-(2-chloro-6-fluorophenyl)acetate
SMILESCOC(=O)C(Nc1cccc(Cl)c1)c1c(F)cccc1Cl
InChIInChI=1S/C15H12Cl2FNO2/c1-21-15(20)14(13-11(17)6-3-7-12(13)18)19-10-5-2-4-9(16)8-10/h2-8,14,19H,1H3
InChIKeyHHWUITMTOCMYKT-UHFFFAOYSA-N
XLogP4.46
TPSA38.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500328.17
LogP ≤ 54.46
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl 2-(3-chloroanilino)-2-(2-chloro-6-fluorophenyl)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(3-chloroanilino)-2-(2-chloro-6-fluorophenyl)acetate?
The IUPAC name of methyl 2-(3-chloroanilino)-2-(2-chloro-6-fluorophenyl)acetate (CID 60991814) is methyl 2-(3-chloroanilino)-2-(2-chloro-6-fluorophenyl)acetate.
What is the SMILES notation for methyl 2-(3-chloroanilino)-2-(2-chloro-6-fluorophenyl)acetate?
The canonical SMILES for methyl 2-(3-chloroanilino)-2-(2-chloro-6-fluorophenyl)acetate is COC(=O)C(Nc1cccc(Cl)c1)c1c(F)cccc1Cl.
What is the InChIKey of methyl 2-(3-chloroanilino)-2-(2-chloro-6-fluorophenyl)acetate?
The InChIKey is HHWUITMTOCMYKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12Cl2FNO2/c1-21-15(20)14(13-11(17)6-3-7-12(13)18)19-10-5-2-4-9(16)8-10/h2-8,14,19H,1H3.
What are the key properties of methyl 2-(3-chloroanilino)-2-(2-chloro-6-fluorophenyl)acetate?
methyl 2-(3-chloroanilino)-2-(2-chloro-6-fluorophenyl)acetate has a molecular weight of 328.17 g/mol, XLogP of 4.46, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(3-chloroanilino)-2-(2-chloro-6-fluorophenyl)acetate is sourced from PubChem (CID 60991814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).