C15H14FNO2S — CID 60991973
2-(4-fluoroanilino)-2-(4-methylsulfanylphenyl)acetic acid (PubChem CID 60991973) has the molecular formula C15H14FNO2S and a molecular weight of 291.35 g/mol. Its IUPAC name is 2-(4-fluoroanilino)-2-(4-methylsulfanylphenyl)acetic acid.
| Compound Name | 2-(4-fluoroanilino)-2-(4-methylsulfanylphenyl)acetic acid |
|---|---|
| PubChem CID | 60991973 |
| Molecular Formula | C15H14FNO2S |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 2-(4-fluoroanilino)-2-(4-methylsulfanylphenyl)acetic acid |
| SMILES | CSc1ccc(C(Nc2ccc(F)cc2)C(=O)O)cc1 |
| InChI | InChI=1S/C15H14FNO2S/c1-20-13-8-2-10(3-9-13)14(15(18)19)17-12-6-4-11(16)5-7-12/h2-9,14,17H,1H3,(H,18,19) |
| InChIKey | AODGJOATNTVRMP-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |