4-methoxy-2,4-dimethyl-2-(2-methylanilino)pentanoic acid

C15H23NO3 — CID 60992455

IUPAC4-methoxy-2,4-dimethyl-2-(2-methylanilino)pentanoic acid
SMILESCOC(C)(C)CC(C)(Nc1ccccc1C)C(=O)O
InChIInChI=1S/C15H23NO3/c1-11-8-6-7-9-12(11)16-15(4,13(17)18)10-14(2,3)19-5/h6-9,16H,10H2,1-5H3,(H,17,18)
InChIKeyQLMNPMMRETVSEE-UHFFFAOYSA-N
MW265.35 g/mol
LogP3.07
Rot. Bonds6

About 4-methoxy-2,4-dimethyl-2-(2-methylanilino)pentanoic acid

4-methoxy-2,4-dimethyl-2-(2-methylanilino)pentanoic acid (PubChem CID 60992455) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is 4-methoxy-2,4-dimethyl-2-(2-methylanilino)pentanoic acid.

Molecular Properties

Compound Name4-methoxy-2,4-dimethyl-2-(2-methylanilino)pentanoic acid
PubChem CID60992455
Molecular FormulaC15H23NO3
Molecular Weight265.35 g/mol
Exact Mass265.17
IUPAC Name4-methoxy-2,4-dimethyl-2-(2-methylanilino)pentanoic acid
SMILESCOC(C)(C)CC(C)(Nc1ccccc1C)C(=O)O
InChIInChI=1S/C15H23NO3/c1-11-8-6-7-9-12(11)16-15(4,13(17)18)10-14(2,3)19-5/h6-9,16H,10H2,1-5H3,(H,17,18)
InChIKeyQLMNPMMRETVSEE-UHFFFAOYSA-N
XLogP3.07
TPSA58.56 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500265.35
LogP ≤ 53.07
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 4-methoxy-2,4-dimethyl-2-(2-methylanilino)pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-methoxy-2,4-dimethyl-2-(2-methylanilino)pentanoic acid?
The IUPAC name of 4-methoxy-2,4-dimethyl-2-(2-methylanilino)pentanoic acid (CID 60992455) is 4-methoxy-2,4-dimethyl-2-(2-methylanilino)pentanoic acid.
What is the SMILES notation for 4-methoxy-2,4-dimethyl-2-(2-methylanilino)pentanoic acid?
The canonical SMILES for 4-methoxy-2,4-dimethyl-2-(2-methylanilino)pentanoic acid is COC(C)(C)CC(C)(Nc1ccccc1C)C(=O)O.
What is the InChIKey of 4-methoxy-2,4-dimethyl-2-(2-methylanilino)pentanoic acid?
The InChIKey is QLMNPMMRETVSEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NO3/c1-11-8-6-7-9-12(11)16-15(4,13(17)18)10-14(2,3)19-5/h6-9,16H,10H2,1-5H3,(H,17,18).
What are the key properties of 4-methoxy-2,4-dimethyl-2-(2-methylanilino)pentanoic acid?
4-methoxy-2,4-dimethyl-2-(2-methylanilino)pentanoic acid has a molecular weight of 265.35 g/mol, XLogP of 3.07, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-2,4-dimethyl-2-(2-methylanilino)pentanoic acid is sourced from PubChem (CID 60992455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).