C16H24N2O3 — CID 60993286
methyl 1-ethyl-4-(3-methoxyanilino)piperidine-4-carboxylate (PubChem CID 60993286) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is methyl 1-ethyl-4-(3-methoxyanilino)piperidine-4-carboxylate.
| Compound Name | methyl 1-ethyl-4-(3-methoxyanilino)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 60993286 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | methyl 1-ethyl-4-(3-methoxyanilino)piperidine-4-carboxylate |
| SMILES | CCN1CCC(Nc2cccc(OC)c2)(C(=O)OC)CC1 |
| InChI | InChI=1S/C16H24N2O3/c1-4-18-10-8-16(9-11-18,15(19)21-3)17-13-6-5-7-14(12-13)20-2/h5-7,12,17H,4,8-11H2,1-3H3 |
| InChIKey | YPHZGHIHFGYKIP-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |