C14H20Cl2N2O2 — CID 60993939
2-(2,3-dichlorophenyl)-2-[2-(diethylamino)ethylamino]acetic acid (PubChem CID 60993939) has the molecular formula C14H20Cl2N2O2 and a molecular weight of 319.23 g/mol. Its IUPAC name is 2-(2,3-dichlorophenyl)-2-[2-(diethylamino)ethylamino]acetic acid.
| Compound Name | 2-(2,3-dichlorophenyl)-2-[2-(diethylamino)ethylamino]acetic acid |
|---|---|
| PubChem CID | 60993939 |
| Molecular Formula | C14H20Cl2N2O2 |
| Molecular Weight | 319.23 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 2-(2,3-dichlorophenyl)-2-[2-(diethylamino)ethylamino]acetic acid |
| SMILES | CCN(CC)CCNC(C(=O)O)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C14H20Cl2N2O2/c1-3-18(4-2)9-8-17-13(14(19)20)10-6-5-7-11(15)12(10)16/h5-7,13,17H,3-4,8-9H2,1-2H3,(H,19,20) |
| InChIKey | UMBWCKCKIIEVMY-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.23 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |