About methyl 2-(1,4-diazepan-1-yl)-2-(3,4-dichlorophenyl)acetate
methyl 2-(1,4-diazepan-1-yl)-2-(3,4-dichlorophenyl)acetate (PubChem CID 60994394) has the molecular formula C14H18Cl2N2O2
and a molecular weight of 317.22 g/mol. Its IUPAC name is methyl 2-(1,4-diazepan-1-yl)-2-(3,4-dichlorophenyl)acetate.
Molecular Properties
| Compound Name | methyl 2-(1,4-diazepan-1-yl)-2-(3,4-dichlorophenyl)acetate |
| PubChem CID | 60994394 |
| Molecular Formula | C14H18Cl2N2O2 |
| Molecular Weight | 317.22 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | methyl 2-(1,4-diazepan-1-yl)-2-(3,4-dichlorophenyl)acetate |
| SMILES | COC(=O)C(c1ccc(Cl)c(Cl)c1)N1CCCNCC1 |
| InChI | InChI=1S/C14H18Cl2N2O2/c1-20-14(19)13(18-7-2-5-17-6-8-18)10-3-4-11(15)12(16)9-10/h3-4,9,13,17H,2,5-8H2,1H3 |
| InChIKey | OGXUZKJAGKTJLY-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.22 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-(1,4-diazepan-1-yl)-2-(3,4-dichlorophenyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(1,4-diazepan-1-yl)-2-(3,4-dichlorophenyl)acetate?
The IUPAC name of methyl 2-(1,4-diazepan-1-yl)-2-(3,4-dichlorophenyl)acetate (CID 60994394) is methyl 2-(1,4-diazepan-1-yl)-2-(3,4-dichlorophenyl)acetate.
What is the SMILES notation for methyl 2-(1,4-diazepan-1-yl)-2-(3,4-dichlorophenyl)acetate?
The canonical SMILES for methyl 2-(1,4-diazepan-1-yl)-2-(3,4-dichlorophenyl)acetate is COC(=O)C(c1ccc(Cl)c(Cl)c1)N1CCCNCC1.
What is the InChIKey of methyl 2-(1,4-diazepan-1-yl)-2-(3,4-dichlorophenyl)acetate?
The InChIKey is OGXUZKJAGKTJLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18Cl2N2O2/c1-20-14(19)13(18-7-2-5-17-6-8-18)10-3-4-11(15)12(16)9-10/h3-4,9,13,17H,2,5-8H2,1H3.
What are the key properties of methyl 2-(1,4-diazepan-1-yl)-2-(3,4-dichlorophenyl)acetate?
methyl 2-(1,4-diazepan-1-yl)-2-(3,4-dichlorophenyl)acetate has a molecular weight of 317.22 g/mol, XLogP of 2.50, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(1,4-diazepan-1-yl)-2-(3,4-dichlorophenyl)acetate is sourced from PubChem (CID 60994394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).