C11H13N3 — CID 60995530
2-(cyclopropylmethylamino)-2-pyridin-3-ylacetonitrile (PubChem CID 60995530) has the molecular formula C11H13N3 and a molecular weight of 187.25 g/mol. Its IUPAC name is 2-(cyclopropylmethylamino)-2-pyridin-3-ylacetonitrile.
| Compound Name | 2-(cyclopropylmethylamino)-2-pyridin-3-ylacetonitrile |
|---|---|
| PubChem CID | 60995530 |
| Molecular Formula | C11H13N3 |
| Molecular Weight | 187.25 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | 2-(cyclopropylmethylamino)-2-pyridin-3-ylacetonitrile |
| SMILES | N#CC(NCC1CC1)c1cccnc1 |
| InChI | InChI=1S/C11H13N3/c12-6-11(14-7-9-3-4-9)10-2-1-5-13-8-10/h1-2,5,8-9,11,14H,3-4,7H2 |
| InChIKey | CMTDCNZMESYXHY-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.25 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |