About 4-chloro-8-iodo-2,3-dimethylquinoline
4-chloro-8-iodo-2,3-dimethylquinoline (PubChem CID 60996384) has the molecular formula C11H9ClIN
and a molecular weight of 317.56 g/mol. Its IUPAC name is 4-chloro-8-iodo-2,3-dimethylquinoline.
Molecular Properties
| Compound Name | 4-chloro-8-iodo-2,3-dimethylquinoline |
| PubChem CID | 60996384 |
| Molecular Formula | C11H9ClIN |
| Molecular Weight | 317.56 g/mol |
| Exact Mass | 316.95 |
| IUPAC Name | 4-chloro-8-iodo-2,3-dimethylquinoline |
| SMILES | Cc1nc2c(I)cccc2c(Cl)c1C |
| InChI | InChI=1S/C11H9ClIN/c1-6-7(2)14-11-8(10(6)12)4-3-5-9(11)13/h3-5H,1-2H3 |
| InChIKey | VYUBNKDYXWFQRO-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.56 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-8-iodo-2,3-dimethylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-8-iodo-2,3-dimethylquinoline?
The IUPAC name of 4-chloro-8-iodo-2,3-dimethylquinoline (CID 60996384) is 4-chloro-8-iodo-2,3-dimethylquinoline.
What is the SMILES notation for 4-chloro-8-iodo-2,3-dimethylquinoline?
The canonical SMILES for 4-chloro-8-iodo-2,3-dimethylquinoline is Cc1nc2c(I)cccc2c(Cl)c1C.
What is the InChIKey of 4-chloro-8-iodo-2,3-dimethylquinoline?
The InChIKey is VYUBNKDYXWFQRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9ClIN/c1-6-7(2)14-11-8(10(6)12)4-3-5-9(11)13/h3-5H,1-2H3.
What are the key properties of 4-chloro-8-iodo-2,3-dimethylquinoline?
4-chloro-8-iodo-2,3-dimethylquinoline has a molecular weight of 317.56 g/mol, XLogP of 4.11, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-8-iodo-2,3-dimethylquinoline is sourced from PubChem (CID 60996384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).