C23H20N2O — CID 609974
3-(4-methylphenyl)-4,6-diphenyl-1,4-dihydropyrimidin-2-one (PubChem CID 609974) has the molecular formula C23H20N2O and a molecular weight of 340.43 g/mol. Its IUPAC name is 3-(4-methylphenyl)-4,6-diphenyl-1,4-dihydropyrimidin-2-one.
| Compound Name | 3-(4-methylphenyl)-4,6-diphenyl-1,4-dihydropyrimidin-2-one |
|---|---|
| PubChem CID | 609974 |
| Molecular Formula | C23H20N2O |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 3-(4-methylphenyl)-4,6-diphenyl-1,4-dihydropyrimidin-2-one |
| SMILES | Cc1ccc(N2C(=O)NC(c3ccccc3)=CC2c2ccccc2)cc1 |
| InChI | InChI=1S/C23H20N2O/c1-17-12-14-20(15-13-17)25-22(19-10-6-3-7-11-19)16-21(24-23(25)26)18-8-4-2-5-9-18/h2-16,22H,1H3,(H,24,26) |
| InChIKey | PDQSBWSUMQXZEJ-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |