About N-[2-(4-bromophenyl)ethyl]-2,2,2-trifluoroethanamine
N-[2-(4-bromophenyl)ethyl]-2,2,2-trifluoroethanamine (PubChem CID 60997763) has the molecular formula C10H11BrF3N
and a molecular weight of 282.10 g/mol. Its IUPAC name is N-[2-(4-bromophenyl)ethyl]-2,2,2-trifluoroethanamine.
Molecular Properties
| Compound Name | N-[2-(4-bromophenyl)ethyl]-2,2,2-trifluoroethanamine |
| PubChem CID | 60997763 |
| Molecular Formula | C10H11BrF3N |
| Molecular Weight | 282.10 g/mol |
| Exact Mass | 281.00 |
| IUPAC Name | N-[2-(4-bromophenyl)ethyl]-2,2,2-trifluoroethanamine |
| SMILES | FC(F)(F)CNCCc1ccc(Br)cc1 |
| InChI | InChI=1S/C10H11BrF3N/c11-9-3-1-8(2-4-9)5-6-15-7-10(12,13)14/h1-4,15H,5-7H2 |
| InChIKey | PMUCDZLOOWBPQJ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.10 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(4-bromophenyl)ethyl]-2,2,2-trifluoroethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(4-bromophenyl)ethyl]-2,2,2-trifluoroethanamine?
The IUPAC name of N-[2-(4-bromophenyl)ethyl]-2,2,2-trifluoroethanamine (CID 60997763) is N-[2-(4-bromophenyl)ethyl]-2,2,2-trifluoroethanamine.
What is the SMILES notation for N-[2-(4-bromophenyl)ethyl]-2,2,2-trifluoroethanamine?
The canonical SMILES for N-[2-(4-bromophenyl)ethyl]-2,2,2-trifluoroethanamine is FC(F)(F)CNCCc1ccc(Br)cc1.
What is the InChIKey of N-[2-(4-bromophenyl)ethyl]-2,2,2-trifluoroethanamine?
The InChIKey is PMUCDZLOOWBPQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11BrF3N/c11-9-3-1-8(2-4-9)5-6-15-7-10(12,13)14/h1-4,15H,5-7H2.
What are the key properties of N-[2-(4-bromophenyl)ethyl]-2,2,2-trifluoroethanamine?
N-[2-(4-bromophenyl)ethyl]-2,2,2-trifluoroethanamine has a molecular weight of 282.10 g/mol, XLogP of 3.14, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(4-bromophenyl)ethyl]-2,2,2-trifluoroethanamine is sourced from PubChem (CID 60997763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).