About 2-(cycloheptylamino)-3,4-dihydro-1H-naphthalene-2-carbonitrile
2-(cycloheptylamino)-3,4-dihydro-1H-naphthalene-2-carbonitrile (PubChem CID 60997796) has the molecular formula C18H24N2
and a molecular weight of 268.40 g/mol. Its IUPAC name is 2-(cycloheptylamino)-3,4-dihydro-1H-naphthalene-2-carbonitrile.
Molecular Properties
| Compound Name | 2-(cycloheptylamino)-3,4-dihydro-1H-naphthalene-2-carbonitrile |
| PubChem CID | 60997796 |
| Molecular Formula | C18H24N2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | 2-(cycloheptylamino)-3,4-dihydro-1H-naphthalene-2-carbonitrile |
| SMILES | N#CC1(NC2CCCCCC2)CCc2ccccc2C1 |
| InChI | InChI=1S/C18H24N2/c19-14-18(20-17-9-3-1-2-4-10-17)12-11-15-7-5-6-8-16(15)13-18/h5-8,17,20H,1-4,9-13H2 |
| InChIKey | FEPYBAMDRVFIRR-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(cycloheptylamino)-3,4-dihydro-1H-naphthalene-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(cycloheptylamino)-3,4-dihydro-1H-naphthalene-2-carbonitrile?
The IUPAC name of 2-(cycloheptylamino)-3,4-dihydro-1H-naphthalene-2-carbonitrile (CID 60997796) is 2-(cycloheptylamino)-3,4-dihydro-1H-naphthalene-2-carbonitrile.
What is the SMILES notation for 2-(cycloheptylamino)-3,4-dihydro-1H-naphthalene-2-carbonitrile?
The canonical SMILES for 2-(cycloheptylamino)-3,4-dihydro-1H-naphthalene-2-carbonitrile is N#CC1(NC2CCCCCC2)CCc2ccccc2C1.
What is the InChIKey of 2-(cycloheptylamino)-3,4-dihydro-1H-naphthalene-2-carbonitrile?
The InChIKey is FEPYBAMDRVFIRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24N2/c19-14-18(20-17-9-3-1-2-4-10-17)12-11-15-7-5-6-8-16(15)13-18/h5-8,17,20H,1-4,9-13H2.
What are the key properties of 2-(cycloheptylamino)-3,4-dihydro-1H-naphthalene-2-carbonitrile?
2-(cycloheptylamino)-3,4-dihydro-1H-naphthalene-2-carbonitrile has a molecular weight of 268.40 g/mol, XLogP of 3.75, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(cycloheptylamino)-3,4-dihydro-1H-naphthalene-2-carbonitrile is sourced from PubChem (CID 60997796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).