About 2-(cycloheptylamino)-2,3-dimethylpentanenitrile
2-(cycloheptylamino)-2,3-dimethylpentanenitrile (PubChem CID 60997908) has the molecular formula C14H26N2
and a molecular weight of 222.38 g/mol. Its IUPAC name is 2-(cycloheptylamino)-2,3-dimethylpentanenitrile.
Molecular Properties
| Compound Name | 2-(cycloheptylamino)-2,3-dimethylpentanenitrile |
| PubChem CID | 60997908 |
| Molecular Formula | C14H26N2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | 2-(cycloheptylamino)-2,3-dimethylpentanenitrile |
| SMILES | CCC(C)C(C)(C#N)NC1CCCCCC1 |
| InChI | InChI=1S/C14H26N2/c1-4-12(2)14(3,11-15)16-13-9-7-5-6-8-10-13/h12-13,16H,4-10H2,1-3H3 |
| InChIKey | ZLSDMSHGGLQHRB-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(cycloheptylamino)-2,3-dimethylpentanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(cycloheptylamino)-2,3-dimethylpentanenitrile?
The IUPAC name of 2-(cycloheptylamino)-2,3-dimethylpentanenitrile (CID 60997908) is 2-(cycloheptylamino)-2,3-dimethylpentanenitrile.
What is the SMILES notation for 2-(cycloheptylamino)-2,3-dimethylpentanenitrile?
The canonical SMILES for 2-(cycloheptylamino)-2,3-dimethylpentanenitrile is CCC(C)C(C)(C#N)NC1CCCCCC1.
What is the InChIKey of 2-(cycloheptylamino)-2,3-dimethylpentanenitrile?
The InChIKey is ZLSDMSHGGLQHRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26N2/c1-4-12(2)14(3,11-15)16-13-9-7-5-6-8-10-13/h12-13,16H,4-10H2,1-3H3.
What are the key properties of 2-(cycloheptylamino)-2,3-dimethylpentanenitrile?
2-(cycloheptylamino)-2,3-dimethylpentanenitrile has a molecular weight of 222.38 g/mol, XLogP of 3.63, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(cycloheptylamino)-2,3-dimethylpentanenitrile is sourced from PubChem (CID 60997908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).