About methyl 2-methyl-2-(2,2,2-trifluoroethylamino)propanoate
methyl 2-methyl-2-(2,2,2-trifluoroethylamino)propanoate (PubChem CID 60997980) has the molecular formula C7H12F3NO2
and a molecular weight of 199.17 g/mol. Its IUPAC name is methyl 2-methyl-2-(2,2,2-trifluoroethylamino)propanoate.
Molecular Properties
| Compound Name | methyl 2-methyl-2-(2,2,2-trifluoroethylamino)propanoate |
| PubChem CID | 60997980 |
| Molecular Formula | C7H12F3NO2 |
| Molecular Weight | 199.17 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | methyl 2-methyl-2-(2,2,2-trifluoroethylamino)propanoate |
| SMILES | COC(=O)C(C)(C)NCC(F)(F)F |
| InChI | InChI=1S/C7H12F3NO2/c1-6(2,5(12)13-3)11-4-7(8,9)10/h11H,4H2,1-3H3 |
| InChIKey | GTTFZTIGJMHCRK-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.17 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 2-methyl-2-(2,2,2-trifluoroethylamino)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-methyl-2-(2,2,2-trifluoroethylamino)propanoate?
The IUPAC name of methyl 2-methyl-2-(2,2,2-trifluoroethylamino)propanoate (CID 60997980) is methyl 2-methyl-2-(2,2,2-trifluoroethylamino)propanoate.
What is the SMILES notation for methyl 2-methyl-2-(2,2,2-trifluoroethylamino)propanoate?
The canonical SMILES for methyl 2-methyl-2-(2,2,2-trifluoroethylamino)propanoate is COC(=O)C(C)(C)NCC(F)(F)F.
What is the InChIKey of methyl 2-methyl-2-(2,2,2-trifluoroethylamino)propanoate?
The InChIKey is GTTFZTIGJMHCRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12F3NO2/c1-6(2,5(12)13-3)11-4-7(8,9)10/h11H,4H2,1-3H3.
What are the key properties of methyl 2-methyl-2-(2,2,2-trifluoroethylamino)propanoate?
methyl 2-methyl-2-(2,2,2-trifluoroethylamino)propanoate has a molecular weight of 199.17 g/mol, XLogP of 1.09, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-methyl-2-(2,2,2-trifluoroethylamino)propanoate is sourced from PubChem (CID 60997980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).