About 3-(2,2,2-trifluoroethylamino)thiolane-3-carboxamide
3-(2,2,2-trifluoroethylamino)thiolane-3-carboxamide (PubChem CID 60998058) has the molecular formula C7H11F3N2OS
and a molecular weight of 228.24 g/mol. Its IUPAC name is 3-(2,2,2-trifluoroethylamino)thiolane-3-carboxamide.
Molecular Properties
| Compound Name | 3-(2,2,2-trifluoroethylamino)thiolane-3-carboxamide |
| PubChem CID | 60998058 |
| Molecular Formula | C7H11F3N2OS |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.05 |
| IUPAC Name | 3-(2,2,2-trifluoroethylamino)thiolane-3-carboxamide |
| SMILES | NC(=O)C1(NCC(F)(F)F)CCSC1 |
| InChI | InChI=1S/C7H11F3N2OS/c8-7(9,10)3-12-6(5(11)13)1-2-14-4-6/h12H,1-4H2,(H2,11,13) |
| InChIKey | SPKCIWBOLIYKMC-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(2,2,2-trifluoroethylamino)thiolane-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,2,2-trifluoroethylamino)thiolane-3-carboxamide?
The IUPAC name of 3-(2,2,2-trifluoroethylamino)thiolane-3-carboxamide (CID 60998058) is 3-(2,2,2-trifluoroethylamino)thiolane-3-carboxamide.
What is the SMILES notation for 3-(2,2,2-trifluoroethylamino)thiolane-3-carboxamide?
The canonical SMILES for 3-(2,2,2-trifluoroethylamino)thiolane-3-carboxamide is NC(=O)C1(NCC(F)(F)F)CCSC1.
What is the InChIKey of 3-(2,2,2-trifluoroethylamino)thiolane-3-carboxamide?
The InChIKey is SPKCIWBOLIYKMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11F3N2OS/c8-7(9,10)3-12-6(5(11)13)1-2-14-4-6/h12H,1-4H2,(H2,11,13).
What are the key properties of 3-(2,2,2-trifluoroethylamino)thiolane-3-carboxamide?
3-(2,2,2-trifluoroethylamino)thiolane-3-carboxamide has a molecular weight of 228.24 g/mol, XLogP of 0.50, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,2,2-trifluoroethylamino)thiolane-3-carboxamide is sourced from PubChem (CID 60998058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).