About 2-(5-bromofuran-2-yl)-1,3-thiazole-4-carbaldehyde
2-(5-bromofuran-2-yl)-1,3-thiazole-4-carbaldehyde (PubChem CID 60998358) has the molecular formula C8H4BrNO2S
and a molecular weight of 258.10 g/mol. Its IUPAC name is 2-(5-bromofuran-2-yl)-1,3-thiazole-4-carbaldehyde.
Molecular Properties
| Compound Name | 2-(5-bromofuran-2-yl)-1,3-thiazole-4-carbaldehyde |
| PubChem CID | 60998358 |
| Molecular Formula | C8H4BrNO2S |
| Molecular Weight | 258.10 g/mol |
| Exact Mass | 256.91 |
| IUPAC Name | 2-(5-bromofuran-2-yl)-1,3-thiazole-4-carbaldehyde |
| SMILES | O=Cc1csc(-c2ccc(Br)o2)n1 |
| InChI | InChI=1S/C8H4BrNO2S/c9-7-2-1-6(12-7)8-10-5(3-11)4-13-8/h1-4H |
| InChIKey | COBQBHKWUBMEEY-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.10 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-(5-bromofuran-2-yl)-1,3-thiazole-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-bromofuran-2-yl)-1,3-thiazole-4-carbaldehyde?
The IUPAC name of 2-(5-bromofuran-2-yl)-1,3-thiazole-4-carbaldehyde (CID 60998358) is 2-(5-bromofuran-2-yl)-1,3-thiazole-4-carbaldehyde.
What is the SMILES notation for 2-(5-bromofuran-2-yl)-1,3-thiazole-4-carbaldehyde?
The canonical SMILES for 2-(5-bromofuran-2-yl)-1,3-thiazole-4-carbaldehyde is O=Cc1csc(-c2ccc(Br)o2)n1.
What is the InChIKey of 2-(5-bromofuran-2-yl)-1,3-thiazole-4-carbaldehyde?
The InChIKey is COBQBHKWUBMEEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4BrNO2S/c9-7-2-1-6(12-7)8-10-5(3-11)4-13-8/h1-4H.
What are the key properties of 2-(5-bromofuran-2-yl)-1,3-thiazole-4-carbaldehyde?
2-(5-bromofuran-2-yl)-1,3-thiazole-4-carbaldehyde has a molecular weight of 258.10 g/mol, XLogP of 2.98, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-bromofuran-2-yl)-1,3-thiazole-4-carbaldehyde is sourced from PubChem (CID 60998358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).