About ethyl 2-ethyl-2-(2,2,2-trifluoroethylamino)butanoate
ethyl 2-ethyl-2-(2,2,2-trifluoroethylamino)butanoate (PubChem CID 60998471) has the molecular formula C10H18F3NO2
and a molecular weight of 241.25 g/mol. Its IUPAC name is ethyl 2-ethyl-2-(2,2,2-trifluoroethylamino)butanoate.
Molecular Properties
| Compound Name | ethyl 2-ethyl-2-(2,2,2-trifluoroethylamino)butanoate |
| PubChem CID | 60998471 |
| Molecular Formula | C10H18F3NO2 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | ethyl 2-ethyl-2-(2,2,2-trifluoroethylamino)butanoate |
| SMILES | CCOC(=O)C(CC)(CC)NCC(F)(F)F |
| InChI | InChI=1S/C10H18F3NO2/c1-4-9(5-2,8(15)16-6-3)14-7-10(11,12)13/h14H,4-7H2,1-3H3 |
| InChIKey | MHAOKJYUKXWXMM-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 2-ethyl-2-(2,2,2-trifluoroethylamino)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-ethyl-2-(2,2,2-trifluoroethylamino)butanoate?
The IUPAC name of ethyl 2-ethyl-2-(2,2,2-trifluoroethylamino)butanoate (CID 60998471) is ethyl 2-ethyl-2-(2,2,2-trifluoroethylamino)butanoate.
What is the SMILES notation for ethyl 2-ethyl-2-(2,2,2-trifluoroethylamino)butanoate?
The canonical SMILES for ethyl 2-ethyl-2-(2,2,2-trifluoroethylamino)butanoate is CCOC(=O)C(CC)(CC)NCC(F)(F)F.
What is the InChIKey of ethyl 2-ethyl-2-(2,2,2-trifluoroethylamino)butanoate?
The InChIKey is MHAOKJYUKXWXMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18F3NO2/c1-4-9(5-2,8(15)16-6-3)14-7-10(11,12)13/h14H,4-7H2,1-3H3.
What are the key properties of ethyl 2-ethyl-2-(2,2,2-trifluoroethylamino)butanoate?
ethyl 2-ethyl-2-(2,2,2-trifluoroethylamino)butanoate has a molecular weight of 241.25 g/mol, XLogP of 2.26, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-ethyl-2-(2,2,2-trifluoroethylamino)butanoate is sourced from PubChem (CID 60998471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).