methyl 2,4-dimethyl-2-(2,2,2-trifluoroethylamino)pentanoate

C10H18F3NO2 — CID 60998954

IUPACmethyl 2,4-dimethyl-2-(2,2,2-trifluoroethylamino)pentanoate
SMILESCOC(=O)C(C)(CC(C)C)NCC(F)(F)F
InChIInChI=1S/C10H18F3NO2/c1-7(2)5-9(3,8(15)16-4)14-6-10(11,12)13/h7,14H,5-6H2,1-4H3
InChIKeyHLWXEJZCSNAIHT-UHFFFAOYSA-N
MW241.25 g/mol
LogP2.12
Rot. Bonds5

About methyl 2,4-dimethyl-2-(2,2,2-trifluoroethylamino)pentanoate

methyl 2,4-dimethyl-2-(2,2,2-trifluoroethylamino)pentanoate (PubChem CID 60998954) has the molecular formula C10H18F3NO2 and a molecular weight of 241.25 g/mol. Its IUPAC name is methyl 2,4-dimethyl-2-(2,2,2-trifluoroethylamino)pentanoate.

Molecular Properties

Compound Namemethyl 2,4-dimethyl-2-(2,2,2-trifluoroethylamino)pentanoate
PubChem CID60998954
Molecular FormulaC10H18F3NO2
Molecular Weight241.25 g/mol
Exact Mass241.13
IUPAC Namemethyl 2,4-dimethyl-2-(2,2,2-trifluoroethylamino)pentanoate
SMILESCOC(=O)C(C)(CC(C)C)NCC(F)(F)F
InChIInChI=1S/C10H18F3NO2/c1-7(2)5-9(3,8(15)16-4)14-6-10(11,12)13/h7,14H,5-6H2,1-4H3
InChIKeyHLWXEJZCSNAIHT-UHFFFAOYSA-N
XLogP2.12
TPSA38.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500241.25
LogP ≤ 52.12
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl 2,4-dimethyl-2-(2,2,2-trifluoroethylamino)pentanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2,4-dimethyl-2-(2,2,2-trifluoroethylamino)pentanoate?
The IUPAC name of methyl 2,4-dimethyl-2-(2,2,2-trifluoroethylamino)pentanoate (CID 60998954) is methyl 2,4-dimethyl-2-(2,2,2-trifluoroethylamino)pentanoate.
What is the SMILES notation for methyl 2,4-dimethyl-2-(2,2,2-trifluoroethylamino)pentanoate?
The canonical SMILES for methyl 2,4-dimethyl-2-(2,2,2-trifluoroethylamino)pentanoate is COC(=O)C(C)(CC(C)C)NCC(F)(F)F.
What is the InChIKey of methyl 2,4-dimethyl-2-(2,2,2-trifluoroethylamino)pentanoate?
The InChIKey is HLWXEJZCSNAIHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18F3NO2/c1-7(2)5-9(3,8(15)16-4)14-6-10(11,12)13/h7,14H,5-6H2,1-4H3.
What are the key properties of methyl 2,4-dimethyl-2-(2,2,2-trifluoroethylamino)pentanoate?
methyl 2,4-dimethyl-2-(2,2,2-trifluoroethylamino)pentanoate has a molecular weight of 241.25 g/mol, XLogP of 2.12, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,4-dimethyl-2-(2,2,2-trifluoroethylamino)pentanoate is sourced from PubChem (CID 60998954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).