About 2-cyclopropyl-2-(2,2,2-trifluoroethylamino)propanenitrile
2-cyclopropyl-2-(2,2,2-trifluoroethylamino)propanenitrile (PubChem CID 60999125) has the molecular formula C8H11F3N2
and a molecular weight of 192.18 g/mol. Its IUPAC name is 2-cyclopropyl-2-(2,2,2-trifluoroethylamino)propanenitrile.
Molecular Properties
| Compound Name | 2-cyclopropyl-2-(2,2,2-trifluoroethylamino)propanenitrile |
| PubChem CID | 60999125 |
| Molecular Formula | C8H11F3N2 |
| Molecular Weight | 192.18 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | 2-cyclopropyl-2-(2,2,2-trifluoroethylamino)propanenitrile |
| SMILES | CC(C#N)(NCC(F)(F)F)C1CC1 |
| InChI | InChI=1S/C8H11F3N2/c1-7(4-12,6-2-3-6)13-5-8(9,10)11/h6,13H,2-3,5H2,1H3 |
| InChIKey | FIZZTLZBSRDVLR-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.18 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-cyclopropyl-2-(2,2,2-trifluoroethylamino)propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-2-(2,2,2-trifluoroethylamino)propanenitrile?
The IUPAC name of 2-cyclopropyl-2-(2,2,2-trifluoroethylamino)propanenitrile (CID 60999125) is 2-cyclopropyl-2-(2,2,2-trifluoroethylamino)propanenitrile.
What is the SMILES notation for 2-cyclopropyl-2-(2,2,2-trifluoroethylamino)propanenitrile?
The canonical SMILES for 2-cyclopropyl-2-(2,2,2-trifluoroethylamino)propanenitrile is CC(C#N)(NCC(F)(F)F)C1CC1.
What is the InChIKey of 2-cyclopropyl-2-(2,2,2-trifluoroethylamino)propanenitrile?
The InChIKey is FIZZTLZBSRDVLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11F3N2/c1-7(4-12,6-2-3-6)13-5-8(9,10)11/h6,13H,2-3,5H2,1H3.
What are the key properties of 2-cyclopropyl-2-(2,2,2-trifluoroethylamino)propanenitrile?
2-cyclopropyl-2-(2,2,2-trifluoroethylamino)propanenitrile has a molecular weight of 192.18 g/mol, XLogP of 1.83, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-2-(2,2,2-trifluoroethylamino)propanenitrile is sourced from PubChem (CID 60999125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).