C14H20N2O2S2 — CID 60999163
3-(cyclohexylsulfamoylmethyl)benzenecarbothioamide (PubChem CID 60999163) has the molecular formula C14H20N2O2S2 and a molecular weight of 312.46 g/mol. Its IUPAC name is 3-(cyclohexylsulfamoylmethyl)benzenecarbothioamide.
| Compound Name | 3-(cyclohexylsulfamoylmethyl)benzenecarbothioamide |
|---|---|
| PubChem CID | 60999163 |
| Molecular Formula | C14H20N2O2S2 |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 3-(cyclohexylsulfamoylmethyl)benzenecarbothioamide |
| SMILES | NC(=S)c1cccc(CS(=O)(=O)NC2CCCCC2)c1 |
| InChI | InChI=1S/C14H20N2O2S2/c15-14(19)12-6-4-5-11(9-12)10-20(17,18)16-13-7-2-1-3-8-13/h4-6,9,13,16H,1-3,7-8,10H2,(H2,15,19) |
| InChIKey | HBIOSTMQEDCRJH-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|