About dichloroplatinum;2-pyridin-2-ylpyridine
dichloroplatinum;2-pyridin-2-ylpyridine (PubChem CID 6099922) has the molecular formula C10H8Cl2N2Pt
and a molecular weight of 422.17 g/mol. Its IUPAC name is dichloroplatinum;2-pyridin-2-ylpyridine.
Molecular Properties
| Compound Name | dichloroplatinum;2-pyridin-2-ylpyridine |
| PubChem CID | 6099922 |
| Molecular Formula | C10H8Cl2N2Pt |
| Molecular Weight | 422.17 g/mol |
| Exact Mass | 420.97 |
| IUPAC Name | dichloroplatinum;2-pyridin-2-ylpyridine |
| SMILES | Cl[Pt]Cl.c1ccc(-c2ccccn2)nc1 |
| InChI | InChI=1S/C10H8N2.2ClH.Pt/c1-3-7-11-9(5-1)10-6-2-4-8-12-10;;;/h1-8H;2*1H;/q;;;+2/p-2 |
| InChIKey | YVQNEQKKLNWXEM-UHFFFAOYSA-L |
| XLogP | 3.52 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.17 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze dichloroplatinum;2-pyridin-2-ylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloroplatinum;2-pyridin-2-ylpyridine?
The IUPAC name of dichloroplatinum;2-pyridin-2-ylpyridine (CID 6099922) is dichloroplatinum;2-pyridin-2-ylpyridine.
What is the SMILES notation for dichloroplatinum;2-pyridin-2-ylpyridine?
The canonical SMILES for dichloroplatinum;2-pyridin-2-ylpyridine is Cl[Pt]Cl.c1ccc(-c2ccccn2)nc1.
What is the InChIKey of dichloroplatinum;2-pyridin-2-ylpyridine?
The InChIKey is YVQNEQKKLNWXEM-UHFFFAOYSA-L. The full InChI is InChI=1S/C10H8N2.2ClH.Pt/c1-3-7-11-9(5-1)10-6-2-4-8-12-10;;;/h1-8H;2*1H;/q;;;+2/p-2.
What are the key properties of dichloroplatinum;2-pyridin-2-ylpyridine?
dichloroplatinum;2-pyridin-2-ylpyridine has a molecular weight of 422.17 g/mol, XLogP of 3.52, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dichloroplatinum;2-pyridin-2-ylpyridine is sourced from PubChem (CID 6099922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).