C16H17BrN2OS — CID 60999470
N-[3-[1-(5-bromothiophen-2-yl)ethylamino]phenyl]cyclopropanecarboxamide (PubChem CID 60999470) has the molecular formula C16H17BrN2OS and a molecular weight of 365.30 g/mol. Its IUPAC name is N-[3-[1-(5-bromothiophen-2-yl)ethylamino]phenyl]cyclopropanecarboxamide.
| Compound Name | N-[3-[1-(5-bromothiophen-2-yl)ethylamino]phenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 60999470 |
| Molecular Formula | C16H17BrN2OS |
| Molecular Weight | 365.30 g/mol |
| Exact Mass | 364.02 |
| IUPAC Name | N-[3-[1-(5-bromothiophen-2-yl)ethylamino]phenyl]cyclopropanecarboxamide |
| SMILES | CC(Nc1cccc(NC(=O)C2CC2)c1)c1ccc(Br)s1 |
| InChI | InChI=1S/C16H17BrN2OS/c1-10(14-7-8-15(17)21-14)18-12-3-2-4-13(9-12)19-16(20)11-5-6-11/h2-4,7-11,18H,5-6H2,1H3,(H,19,20) |
| InChIKey | BAHGFCLGIQGIQT-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.30 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |