About N-(1H-pyrazol-4-ylmethyl)thieno[3,2-d]pyrimidin-4-amine
N-(1H-pyrazol-4-ylmethyl)thieno[3,2-d]pyrimidin-4-amine (PubChem CID 61000868) has the molecular formula C10H9N5S
and a molecular weight of 231.28 g/mol. Its IUPAC name is N-(1H-pyrazol-4-ylmethyl)thieno[3,2-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | N-(1H-pyrazol-4-ylmethyl)thieno[3,2-d]pyrimidin-4-amine |
| PubChem CID | 61000868 |
| Molecular Formula | C10H9N5S |
| Molecular Weight | 231.28 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | N-(1H-pyrazol-4-ylmethyl)thieno[3,2-d]pyrimidin-4-amine |
| SMILES | c1nc(NCc2cn[nH]c2)c2sccc2n1 |
| InChI | InChI=1S/C10H9N5S/c1-2-16-9-8(1)12-6-13-10(9)11-3-7-4-14-15-5-7/h1-2,4-6H,3H2,(H,14,15)(H,11,12,13) |
| InChIKey | MOJOGOBOGZRZRZ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.28 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(1H-pyrazol-4-ylmethyl)thieno[3,2-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1H-pyrazol-4-ylmethyl)thieno[3,2-d]pyrimidin-4-amine?
The IUPAC name of N-(1H-pyrazol-4-ylmethyl)thieno[3,2-d]pyrimidin-4-amine (CID 61000868) is N-(1H-pyrazol-4-ylmethyl)thieno[3,2-d]pyrimidin-4-amine.
What is the SMILES notation for N-(1H-pyrazol-4-ylmethyl)thieno[3,2-d]pyrimidin-4-amine?
The canonical SMILES for N-(1H-pyrazol-4-ylmethyl)thieno[3,2-d]pyrimidin-4-amine is c1nc(NCc2cn[nH]c2)c2sccc2n1.
What is the InChIKey of N-(1H-pyrazol-4-ylmethyl)thieno[3,2-d]pyrimidin-4-amine?
The InChIKey is MOJOGOBOGZRZRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N5S/c1-2-16-9-8(1)12-6-13-10(9)11-3-7-4-14-15-5-7/h1-2,4-6H,3H2,(H,14,15)(H,11,12,13).
What are the key properties of N-(1H-pyrazol-4-ylmethyl)thieno[3,2-d]pyrimidin-4-amine?
N-(1H-pyrazol-4-ylmethyl)thieno[3,2-d]pyrimidin-4-amine has a molecular weight of 231.28 g/mol, XLogP of 2.03, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1H-pyrazol-4-ylmethyl)thieno[3,2-d]pyrimidin-4-amine is sourced from PubChem (CID 61000868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).