C14H17F2NO3 — CID 61001845
2-(cyclopropylmethylamino)-2-[4-(difluoromethoxy)phenyl]propanoic acid (PubChem CID 61001845) has the molecular formula C14H17F2NO3 and a molecular weight of 285.29 g/mol. Its IUPAC name is 2-(cyclopropylmethylamino)-2-[4-(difluoromethoxy)phenyl]propanoic acid.
| Compound Name | 2-(cyclopropylmethylamino)-2-[4-(difluoromethoxy)phenyl]propanoic acid |
|---|---|
| PubChem CID | 61001845 |
| Molecular Formula | C14H17F2NO3 |
| Molecular Weight | 285.29 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 2-(cyclopropylmethylamino)-2-[4-(difluoromethoxy)phenyl]propanoic acid |
| SMILES | CC(NCC1CC1)(C(=O)O)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C14H17F2NO3/c1-14(12(18)19,17-8-9-2-3-9)10-4-6-11(7-5-10)20-13(15)16/h4-7,9,13,17H,2-3,8H2,1H3,(H,18,19) |
| InChIKey | YHTFBEWNQWRYJC-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.29 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |