C17H27NO3 — CID 61002775
ethyl 2-(2-methylpropylamino)-2-(4-propan-2-yloxyphenyl)acetate (PubChem CID 61002775) has the molecular formula C17H27NO3 and a molecular weight of 293.41 g/mol. Its IUPAC name is ethyl 2-(2-methylpropylamino)-2-(4-propan-2-yloxyphenyl)acetate.
| Compound Name | ethyl 2-(2-methylpropylamino)-2-(4-propan-2-yloxyphenyl)acetate |
|---|---|
| PubChem CID | 61002775 |
| Molecular Formula | C17H27NO3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | ethyl 2-(2-methylpropylamino)-2-(4-propan-2-yloxyphenyl)acetate |
| SMILES | CCOC(=O)C(NCC(C)C)c1ccc(OC(C)C)cc1 |
| InChI | InChI=1S/C17H27NO3/c1-6-20-17(19)16(18-11-12(2)3)14-7-9-15(10-8-14)21-13(4)5/h7-10,12-13,16,18H,6,11H2,1-5H3 |
| InChIKey | GOXUJROREWORPM-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |