About 3,5-ditert-butyl-4-hydroxycyclohexa-2,4-dien-1-one
3,5-ditert-butyl-4-hydroxycyclohexa-2,4-dien-1-one (PubChem CID 610030) has the molecular formula C14H22O2
and a molecular weight of 222.33 g/mol. Its IUPAC name is 3,5-ditert-butyl-4-hydroxycyclohexa-2,4-dien-1-one.
Molecular Properties
| Compound Name | 3,5-ditert-butyl-4-hydroxycyclohexa-2,4-dien-1-one |
| PubChem CID | 610030 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | 3,5-ditert-butyl-4-hydroxycyclohexa-2,4-dien-1-one |
| SMILES | CC(C)(C)C1=CC(=O)CC(C(C)(C)C)=C1O |
| InChI | InChI=1S/C14H22O2/c1-13(2,3)10-7-9(15)8-11(12(10)16)14(4,5)6/h7,16H,8H2,1-6H3 |
| InChIKey | VMIBWUBKVGANRX-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,5-ditert-butyl-4-hydroxycyclohexa-2,4-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-ditert-butyl-4-hydroxycyclohexa-2,4-dien-1-one?
The IUPAC name of 3,5-ditert-butyl-4-hydroxycyclohexa-2,4-dien-1-one (CID 610030) is 3,5-ditert-butyl-4-hydroxycyclohexa-2,4-dien-1-one.
What is the SMILES notation for 3,5-ditert-butyl-4-hydroxycyclohexa-2,4-dien-1-one?
The canonical SMILES for 3,5-ditert-butyl-4-hydroxycyclohexa-2,4-dien-1-one is CC(C)(C)C1=CC(=O)CC(C(C)(C)C)=C1O.
What is the InChIKey of 3,5-ditert-butyl-4-hydroxycyclohexa-2,4-dien-1-one?
The InChIKey is VMIBWUBKVGANRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O2/c1-13(2,3)10-7-9(15)8-11(12(10)16)14(4,5)6/h7,16H,8H2,1-6H3.
What are the key properties of 3,5-ditert-butyl-4-hydroxycyclohexa-2,4-dien-1-one?
3,5-ditert-butyl-4-hydroxycyclohexa-2,4-dien-1-one has a molecular weight of 222.33 g/mol, XLogP of 3.79, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-ditert-butyl-4-hydroxycyclohexa-2,4-dien-1-one is sourced from PubChem (CID 610030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).