About N-[(4-methyl-1,2,4-triazol-3-yl)methyl]prop-2-enamide
N-[(4-methyl-1,2,4-triazol-3-yl)methyl]prop-2-enamide (PubChem CID 61003321) has the molecular formula C7H10N4O
and a molecular weight of 166.18 g/mol. Its IUPAC name is N-[(4-methyl-1,2,4-triazol-3-yl)methyl]prop-2-enamide.
Molecular Properties
| Compound Name | N-[(4-methyl-1,2,4-triazol-3-yl)methyl]prop-2-enamide |
| PubChem CID | 61003321 |
| Molecular Formula | C7H10N4O |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.09 |
| IUPAC Name | N-[(4-methyl-1,2,4-triazol-3-yl)methyl]prop-2-enamide |
| SMILES | C=CC(=O)NCc1nncn1C |
| InChI | InChI=1S/C7H10N4O/c1-3-7(12)8-4-6-10-9-5-11(6)2/h3,5H,1,4H2,2H3,(H,8,12) |
| InChIKey | GXNQHPOKECVUJN-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-[(4-methyl-1,2,4-triazol-3-yl)methyl]prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4-methyl-1,2,4-triazol-3-yl)methyl]prop-2-enamide?
The IUPAC name of N-[(4-methyl-1,2,4-triazol-3-yl)methyl]prop-2-enamide (CID 61003321) is N-[(4-methyl-1,2,4-triazol-3-yl)methyl]prop-2-enamide.
What is the SMILES notation for N-[(4-methyl-1,2,4-triazol-3-yl)methyl]prop-2-enamide?
The canonical SMILES for N-[(4-methyl-1,2,4-triazol-3-yl)methyl]prop-2-enamide is C=CC(=O)NCc1nncn1C.
What is the InChIKey of N-[(4-methyl-1,2,4-triazol-3-yl)methyl]prop-2-enamide?
The InChIKey is GXNQHPOKECVUJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N4O/c1-3-7(12)8-4-6-10-9-5-11(6)2/h3,5H,1,4H2,2H3,(H,8,12).
What are the key properties of N-[(4-methyl-1,2,4-triazol-3-yl)methyl]prop-2-enamide?
N-[(4-methyl-1,2,4-triazol-3-yl)methyl]prop-2-enamide has a molecular weight of 166.18 g/mol, XLogP of -0.38, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4-methyl-1,2,4-triazol-3-yl)methyl]prop-2-enamide is sourced from PubChem (CID 61003321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).