About 4-hydroxy-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]pyrrolidine-2-carboxamide
4-hydroxy-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]pyrrolidine-2-carboxamide (PubChem CID 61003544) has the molecular formula C9H15N5O2
and a molecular weight of 225.25 g/mol. Its IUPAC name is 4-hydroxy-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]pyrrolidine-2-carboxamide.
Molecular Properties
| Compound Name | 4-hydroxy-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]pyrrolidine-2-carboxamide |
| PubChem CID | 61003544 |
| Molecular Formula | C9H15N5O2 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 4-hydroxy-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]pyrrolidine-2-carboxamide |
| SMILES | Cn1cnnc1CNC(=O)C1CC(O)CN1 |
| InChI | InChI=1S/C9H15N5O2/c1-14-5-12-13-8(14)4-11-9(16)7-2-6(15)3-10-7/h5-7,10,15H,2-4H2,1H3,(H,11,16) |
| InChIKey | YNELSQCORHITBK-UHFFFAOYSA-N |
| XLogP | -1.85 |
| TPSA | 92.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-hydroxy-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]pyrrolidine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]pyrrolidine-2-carboxamide?
The IUPAC name of 4-hydroxy-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]pyrrolidine-2-carboxamide (CID 61003544) is 4-hydroxy-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]pyrrolidine-2-carboxamide.
What is the SMILES notation for 4-hydroxy-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]pyrrolidine-2-carboxamide?
The canonical SMILES for 4-hydroxy-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]pyrrolidine-2-carboxamide is Cn1cnnc1CNC(=O)C1CC(O)CN1.
What is the InChIKey of 4-hydroxy-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]pyrrolidine-2-carboxamide?
The InChIKey is YNELSQCORHITBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N5O2/c1-14-5-12-13-8(14)4-11-9(16)7-2-6(15)3-10-7/h5-7,10,15H,2-4H2,1H3,(H,11,16).
What are the key properties of 4-hydroxy-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]pyrrolidine-2-carboxamide?
4-hydroxy-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]pyrrolidine-2-carboxamide has a molecular weight of 225.25 g/mol, XLogP of -1.85, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]pyrrolidine-2-carboxamide is sourced from PubChem (CID 61003544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).