About diphenyllead(2+);bis(pyrrol-1-ide)
diphenyllead(2+);bis(pyrrol-1-ide) (PubChem CID 6100367) has the molecular formula C20H18N2Pb
and a molecular weight of 493.58 g/mol. Its IUPAC name is diphenyllead(2+);bis(pyrrol-1-ide).
Molecular Properties
| Compound Name | diphenyllead(2+);bis(pyrrol-1-ide) |
| PubChem CID | 6100367 |
| Molecular Formula | C20H18N2Pb |
| Molecular Weight | 493.58 g/mol |
| Exact Mass | 494.12 |
| IUPAC Name | diphenyllead(2+);bis(pyrrol-1-ide) |
| SMILES | c1cc[n-]c1.c1cc[n-]c1.c1ccc([Pb+2]c2ccccc2)cc1 |
| InChI | InChI=1S/2C6H5.2C4H4N.Pb/c2*1-2-4-6-5-3-1;2*1-2-4-5-3-1;/h2*1-5H;2*1-4H;/q;;2*-1;+2 |
| InChIKey | GKZHQLXZJOLRPW-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 28.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 493.58 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze diphenyllead(2+);bis(pyrrol-1-ide) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenyllead(2+);bis(pyrrol-1-ide)?
The IUPAC name of diphenyllead(2+);bis(pyrrol-1-ide) (CID 6100367) is diphenyllead(2+);bis(pyrrol-1-ide).
What is the SMILES notation for diphenyllead(2+);bis(pyrrol-1-ide)?
The canonical SMILES for diphenyllead(2+);bis(pyrrol-1-ide) is c1cc[n-]c1.c1cc[n-]c1.c1ccc([Pb+2]c2ccccc2)cc1.
What is the InChIKey of diphenyllead(2+);bis(pyrrol-1-ide)?
The InChIKey is GKZHQLXZJOLRPW-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H5.2C4H4N.Pb/c2*1-2-4-6-5-3-1;2*1-2-4-5-3-1;/h2*1-5H;2*1-4H;/q;;2*-1;+2.
What are the key properties of diphenyllead(2+);bis(pyrrol-1-ide)?
diphenyllead(2+);bis(pyrrol-1-ide) has a molecular weight of 493.58 g/mol, XLogP of 2.63, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for diphenyllead(2+);bis(pyrrol-1-ide) is sourced from PubChem (CID 6100367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).