C13H16N4O3 — CID 61004095
3-[(4-methyl-1,2,4-triazol-3-yl)methylcarbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 61004095) has the molecular formula C13H16N4O3 and a molecular weight of 276.30 g/mol. Its IUPAC name is 3-[(4-methyl-1,2,4-triazol-3-yl)methylcarbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | 3-[(4-methyl-1,2,4-triazol-3-yl)methylcarbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 61004095 |
| Molecular Formula | C13H16N4O3 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 3-[(4-methyl-1,2,4-triazol-3-yl)methylcarbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | Cn1cnnc1CNC(=O)C1C2C=CC(C2)C1C(=O)O |
| InChI | InChI=1S/C13H16N4O3/c1-17-6-15-16-9(17)5-14-12(18)10-7-2-3-8(4-7)11(10)13(19)20/h2-3,6-8,10-11H,4-5H2,1H3,(H,14,18)(H,19,20) |
| InChIKey | RXGSTQHKCINORW-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|