C8H12N4O2 — CID 61004110
N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-3-oxobutanamide (PubChem CID 61004110) has the molecular formula C8H12N4O2 and a molecular weight of 196.21 g/mol. Its IUPAC name is N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-3-oxobutanamide.
| Compound Name | N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-3-oxobutanamide |
|---|---|
| PubChem CID | 61004110 |
| Molecular Formula | C8H12N4O2 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-3-oxobutanamide |
| SMILES | CC(=O)CC(=O)NCc1nncn1C |
| InChI | InChI=1S/C8H12N4O2/c1-6(13)3-8(14)9-4-7-11-10-5-12(7)2/h5H,3-4H2,1-2H3,(H,9,14) |
| InChIKey | VOQHEOWIAUPAGZ-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|