C13H21N5O2 — CID 61004431
3-[(4-methyl-1,2,4-triazol-3-yl)methylamino]-1-pentan-3-ylpyrrolidine-2,5-dione (PubChem CID 61004431) has the molecular formula C13H21N5O2 and a molecular weight of 279.34 g/mol. Its IUPAC name is 3-[(4-methyl-1,2,4-triazol-3-yl)methylamino]-1-pentan-3-ylpyrrolidine-2,5-dione.
| Compound Name | 3-[(4-methyl-1,2,4-triazol-3-yl)methylamino]-1-pentan-3-ylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 61004431 |
| Molecular Formula | C13H21N5O2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | 3-[(4-methyl-1,2,4-triazol-3-yl)methylamino]-1-pentan-3-ylpyrrolidine-2,5-dione |
| SMILES | CCC(CC)N1C(=O)CC(NCc2nncn2C)C1=O |
| InChI | InChI=1S/C13H21N5O2/c1-4-9(5-2)18-12(19)6-10(13(18)20)14-7-11-16-15-8-17(11)3/h8-10,14H,4-7H2,1-3H3 |
| InChIKey | JSGMMPKQIFFPOP-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|