About 3-chloro-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]propane-1-sulfonamide
3-chloro-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]propane-1-sulfonamide (PubChem CID 61004437) has the molecular formula C7H13ClN4O2S
and a molecular weight of 252.73 g/mol. Its IUPAC name is 3-chloro-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]propane-1-sulfonamide.
Molecular Properties
| Compound Name | 3-chloro-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]propane-1-sulfonamide |
| PubChem CID | 61004437 |
| Molecular Formula | C7H13ClN4O2S |
| Molecular Weight | 252.73 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | 3-chloro-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]propane-1-sulfonamide |
| SMILES | Cn1cnnc1CNS(=O)(=O)CCCCl |
| InChI | InChI=1S/C7H13ClN4O2S/c1-12-6-9-11-7(12)5-10-15(13,14)4-2-3-8/h6,10H,2-5H2,1H3 |
| InChIKey | IBLRMZUWVSOLIG-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.73 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]propane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]propane-1-sulfonamide?
The IUPAC name of 3-chloro-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]propane-1-sulfonamide (CID 61004437) is 3-chloro-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]propane-1-sulfonamide.
What is the SMILES notation for 3-chloro-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]propane-1-sulfonamide?
The canonical SMILES for 3-chloro-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]propane-1-sulfonamide is Cn1cnnc1CNS(=O)(=O)CCCCl.
What is the InChIKey of 3-chloro-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]propane-1-sulfonamide?
The InChIKey is IBLRMZUWVSOLIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13ClN4O2S/c1-12-6-9-11-7(12)5-10-15(13,14)4-2-3-8/h6,10H,2-5H2,1H3.
What are the key properties of 3-chloro-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]propane-1-sulfonamide?
3-chloro-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]propane-1-sulfonamide has a molecular weight of 252.73 g/mol, XLogP of -0.14, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]propane-1-sulfonamide is sourced from PubChem (CID 61004437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).