About 1-ethyl-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]piperidin-4-amine
1-ethyl-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]piperidin-4-amine (PubChem CID 61004668) has the molecular formula C11H21N5
and a molecular weight of 223.32 g/mol. Its IUPAC name is 1-ethyl-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]piperidin-4-amine.
Molecular Properties
| Compound Name | 1-ethyl-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]piperidin-4-amine |
| PubChem CID | 61004668 |
| Molecular Formula | C11H21N5 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.18 |
| IUPAC Name | 1-ethyl-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]piperidin-4-amine |
| SMILES | CCN1CCC(NCc2nncn2C)CC1 |
| InChI | InChI=1S/C11H21N5/c1-3-16-6-4-10(5-7-16)12-8-11-14-13-9-15(11)2/h9-10,12H,3-8H2,1-2H3 |
| InChIKey | BLYLNFKMWPQEQH-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-ethyl-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]piperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]piperidin-4-amine?
The IUPAC name of 1-ethyl-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]piperidin-4-amine (CID 61004668) is 1-ethyl-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]piperidin-4-amine.
What is the SMILES notation for 1-ethyl-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]piperidin-4-amine?
The canonical SMILES for 1-ethyl-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]piperidin-4-amine is CCN1CCC(NCc2nncn2C)CC1.
What is the InChIKey of 1-ethyl-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]piperidin-4-amine?
The InChIKey is BLYLNFKMWPQEQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N5/c1-3-16-6-4-10(5-7-16)12-8-11-14-13-9-15(11)2/h9-10,12H,3-8H2,1-2H3.
What are the key properties of 1-ethyl-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]piperidin-4-amine?
1-ethyl-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]piperidin-4-amine has a molecular weight of 223.32 g/mol, XLogP of 0.39, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]piperidin-4-amine is sourced from PubChem (CID 61004668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).